【 WhatsApp】
+86-21-6420 0566
8613816217984
| OEM | OEM Services Provided |
| Feature | Easy to Use Eco-friendly |
| Classification | Dyes and Pigments |
| Advantage | Professional, Fast Delivery, Customizable | Samples | Apply for free，Contact us now. |
| Common Name | Basic Blue 26 | ||
|---|---|---|---|
| CAS Number | 2580-56-5 | Molecular Weight | 506.080 |
| Density | / | Boiling Point | 620.4ºC at 760mmHg |
| Molecular Formula | C33H32ClN3 | Melting Point | 206 °C (dec.)(lit.) |
| MSDS | / | Flash Point | 70ºC |
| Name | victoria blue B |
|---|---|
| Synonym | More Synonyms |
| Description | Basic Blue 26 is a biochemical reagent that can be used as a biological material or organic compound for life science related research. |
|---|---|
| Related Catalog | Research Areas >>Others |
| Boiling Point | 620.4ºC at 760mmHg |
|---|---|
| Melting Point | 206 °C (dec.)(lit.) |
| Molecular Formula | C33H32ClN3 |
| Molecular Weight | 506.080 |
| Flash Point | 70ºC |
| Exact Mass | 505.228485 |
| PSA | 18.28000 |
| LogP | 4.36740 |
| InChIKey | LLWJPGAKXJBKKA-UHFFFAOYSA-N |
| SMILES | CN(C)c1ccc(C(=C2C=CC(=[NH+]c3ccccc3)c3ccccc32)c2ccc(N(C)C)cc2)cc1.[Cl-] |
| Water Solubility | SOLUBLE IN HOT WATER |
| Hazard Codes | Xn:Harmful |
|---|---|
| Risk Phrases | R22;R36 |
| Safety Phrases | S26 |
| WGK Germany | 3 |
| HS Code | 2921499090 |
| HS Code | 2921499090 |
|---|---|
| Summary | 2921499090 other aromatic monoamines and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| EINECS 219-943-6 |
| Calcozine Blue B |
| Tertrophene Blue |
| C.I.Basicblue26 |
| N-(4-{[4-(dimethylamino)phenyl][4-(phenylamino)naphthalen-1-yl]methylidene}cyclohexa-2,5-dien-1-ylidene)-N-methylmethanaminium chloride |
| Vitoria blue B |
| HectoBlueB |
| (4-((4-Anilino-1-naphthyl)(4-(dimethylamino)phenyl)methylene)cyclohexa-2,5-dien-1-ylidene)dimethylammonium chloride |
| Methanaminium, N-(4-((4-(dimethylamino)phenyl)(4-(phenylamino)-1-naphthalenyl)methylene)-2,5-cyclohexadien-1-ylidene)-N-methyl-, chloride |
| Corn blue BN |
| Basic Blue 26 |
| Hidaco Victoria Blue B |
| Methanaminium, N-[4-[[4-(dimethylamino)phenyl][4-(phenylamino)-1-naphthalenyl]methylene]-2,5-cyclohexadien-1-ylidene]-N-methyl-, chloride (1:1) |
| BASIC BLUE B |
| N-(4-{(4-Anilino-1-naphthyl)[4-(dimethylamino)phenyl]methylene}cyclohexa-2,5-dien-1-ylidene)-N-methylmethanaminium chloride |
| Victoria Blue |
| Hidaco Victoria Blue B Base |
| Aizen Victoria Blue BH |
| Mitsui Victoria Blue B |
| ADC Victoria Blue B |
| Hekto Blue B |
| Flexo Blue 640 |
| Symulex Blue BOF |
| Victoria Lake Blue B |
| MFCD00011878 |
| 4-{(4-Anilino-1-naphthyl)[4-(dimethylamino)phenyl]methylene}-N,N-dimethyl-2,5-cyclohexadien-1-iminium chloride |
| N-(4-((4-(Dimethylamino)phenyl)(4-(phenylamino)-1-naphthalenyl)methylene)-2,5- cyclohexadien-1-ylidene)-N-methylmethanaminium, chloride |
| Victoria Blue B |
| VICTORIA PURE BLUE B |
| Hecto Blue B |
| VictoriaBA |
| Victoria Blue B (VAN) |
Ready to Start?
For help with solutions customized to your business needs, contact Export Director now.
Export Director
With 30+ years of experience and We firmly believe that product quality is the basis of cooperation.
Chat Now
Phone
8613816217984
Working hours
Monday to Friday
TEl
+86-21-6420 0566
